About bis(tetramethylphosphanium);sulfite
bis(tetramethylphosphanium);sulfite (PubChem CID 146316753) has the molecular formula C8H24O3P2S
and a molecular weight of 262.29 g/mol. Its IUPAC name is bis(tetramethylphosphanium);sulfite.
Molecular Properties
| Compound Name | bis(tetramethylphosphanium);sulfite |
| PubChem CID | 146316753 |
| Molecular Formula | C8H24O3P2S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | bis(tetramethylphosphanium);sulfite |
| SMILES | C[P+](C)(C)C.C[P+](C)(C)C.O=S([O-])[O-] |
| InChI | InChI=1S/2C4H12P.H2O3S/c2*1-5(2,3)4;1-4(2)3/h2*1-4H3;(H2,1,2,3)/q2*+1;/p-2 |
| InChIKey | SYZZCAROTVXWON-UHFFFAOYSA-L |
| XLogP | 2.04 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze bis(tetramethylphosphanium);sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(tetramethylphosphanium);sulfite?
The IUPAC name of bis(tetramethylphosphanium);sulfite (CID 146316753) is bis(tetramethylphosphanium);sulfite.
What is the SMILES notation for bis(tetramethylphosphanium);sulfite?
The canonical SMILES for bis(tetramethylphosphanium);sulfite is C[P+](C)(C)C.C[P+](C)(C)C.O=S([O-])[O-].
What is the InChIKey of bis(tetramethylphosphanium);sulfite?
The InChIKey is SYZZCAROTVXWON-UHFFFAOYSA-L. The full InChI is InChI=1S/2C4H12P.H2O3S/c2*1-5(2,3)4;1-4(2)3/h2*1-4H3;(H2,1,2,3)/q2*+1;/p-2.
What are the key properties of bis(tetramethylphosphanium);sulfite?
bis(tetramethylphosphanium);sulfite has a molecular weight of 262.29 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(tetramethylphosphanium);sulfite is sourced from PubChem (CID 146316753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).