C22H27FN6O — CID 146316841
N-[1-(8-cyanoquinoxalin-5-yl)-5-methylpiperidin-3-yl]-2-(4-fluoropiperidin-4-yl)acetamide (PubChem CID 146316841) has the molecular formula C22H27FN6O and a molecular weight of 410.50 g/mol. Its IUPAC name is N-[1-(8-cyanoquinoxalin-5-yl)-5-methylpiperidin-3-yl]-2-(4-fluoropiperidin-4-yl)acetamide.
| Compound Name | N-[1-(8-cyanoquinoxalin-5-yl)-5-methylpiperidin-3-yl]-2-(4-fluoropiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 146316841 |
| Molecular Formula | C22H27FN6O |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | N-[1-(8-cyanoquinoxalin-5-yl)-5-methylpiperidin-3-yl]-2-(4-fluoropiperidin-4-yl)acetamide |
| SMILES | CC1CC(NC(=O)CC2(F)CCNCC2)CN(c2ccc(C#N)c3nccnc23)C1 |
| InChI | InChI=1S/C22H27FN6O/c1-15-10-17(28-19(30)11-22(23)4-6-25-7-5-22)14-29(13-15)18-3-2-16(12-24)20-21(18)27-9-8-26-20/h2-3,8-9,15,17,25H,4-7,10-11,13-14H2,1H3,(H,28,30) |
| InChIKey | SCSWMKVKYPRYFJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |