C24H27FN4O3 — CID 146317044
(7S)-7-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-7-[6-(1,2-oxazol-3-yl)-6-oxohexyl]azepan-2-one (PubChem CID 146317044) has the molecular formula C24H27FN4O3 and a molecular weight of 438.50 g/mol. Its IUPAC name is (7S)-7-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-7-[6-(1,2-oxazol-3-yl)-6-oxohexyl]azepan-2-one.
| Compound Name | (7S)-7-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-7-[6-(1,2-oxazol-3-yl)-6-oxohexyl]azepan-2-one |
|---|---|
| PubChem CID | 146317044 |
| Molecular Formula | C24H27FN4O3 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | (7S)-7-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-7-[6-(1,2-oxazol-3-yl)-6-oxohexyl]azepan-2-one |
| SMILES | O=C1CCCC[C@@](CCCCCC(=O)c2ccon2)(c2ncc(-c3ccccc3F)[nH]2)N1 |
| InChI | InChI=1S/C24H27FN4O3/c25-18-9-4-3-8-17(18)20-16-26-23(27-20)24(14-7-5-11-22(31)28-24)13-6-1-2-10-21(30)19-12-15-32-29-19/h3-4,8-9,12,15-16H,1-2,5-7,10-11,13-14H2,(H,26,27)(H,28,31)/t24-/m0/s1 |
| InChIKey | VGMIKEUTJODWHV-DEOSSOPVSA-N |
| XLogP | 4.92 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|