C22H23FN4O3 — CID 146317092
(5S)-5-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-5-[6-(1,2-oxazol-3-yl)-6-oxohexyl]pyrrolidin-2-one (PubChem CID 146317092) has the molecular formula C22H23FN4O3 and a molecular weight of 410.45 g/mol. Its IUPAC name is (5S)-5-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-5-[6-(1,2-oxazol-3-yl)-6-oxohexyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-5-[6-(1,2-oxazol-3-yl)-6-oxohexyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 146317092 |
| Molecular Formula | C22H23FN4O3 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (5S)-5-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-5-[6-(1,2-oxazol-3-yl)-6-oxohexyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@](CCCCCC(=O)c2ccon2)(c2ncc(-c3ccccc3F)[nH]2)N1 |
| InChI | InChI=1S/C22H23FN4O3/c23-16-7-4-3-6-15(16)18-14-24-21(25-18)22(12-9-20(29)26-22)11-5-1-2-8-19(28)17-10-13-30-27-17/h3-4,6-7,10,13-14H,1-2,5,8-9,11-12H2,(H,24,25)(H,26,29)/t22-/m0/s1 |
| InChIKey | VIZXPEJGBCBWBB-QFIPXVFZSA-N |
| XLogP | 4.14 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|