C19H15F17N2O2 — CID 146317101
3-N-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide (PubChem CID 146317101) has the molecular formula C19H15F17N2O2 and a molecular weight of 626.31 g/mol. Its IUPAC name is 3-N-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide.
| Compound Name | 3-N-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 146317101 |
| Molecular Formula | C19H15F17N2O2 |
| Molecular Weight | 626.31 g/mol |
| Exact Mass | 626.09 |
| IUPAC Name | 3-N-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)bicyclo[2.2.1]hept-5-ene-2,3-dicarboxamide |
| SMILES | NC(=O)C1C2C=CC(C2)C1C(=O)NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H15F17N2O2/c20-12(21,3-4-38-11(40)9-7-2-1-6(5-7)8(9)10(37)39)13(22,23)14(24,25)15(26,27)16(28,29)17(30,31)18(32,33)19(34,35)36/h1-2,6-9H,3-5H2,(H2,37,39)(H,38,40) |
| InChIKey | SZWZIMLXWLQZHI-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.31 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|