C11H8F3N5O2 — CID 146317107
methyl 4-amino-6-(3,4,5-trifluoroanilino)-1,3,5-triazine-2-carboxylate (PubChem CID 146317107) has the molecular formula C11H8F3N5O2 and a molecular weight of 299.21 g/mol. Its IUPAC name is methyl 4-amino-6-(3,4,5-trifluoroanilino)-1,3,5-triazine-2-carboxylate.
| Compound Name | methyl 4-amino-6-(3,4,5-trifluoroanilino)-1,3,5-triazine-2-carboxylate |
|---|---|
| PubChem CID | 146317107 |
| Molecular Formula | C11H8F3N5O2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | methyl 4-amino-6-(3,4,5-trifluoroanilino)-1,3,5-triazine-2-carboxylate |
| SMILES | COC(=O)c1nc(N)nc(Nc2cc(F)c(F)c(F)c2)n1 |
| InChI | InChI=1S/C11H8F3N5O2/c1-21-9(20)8-17-10(15)19-11(18-8)16-4-2-5(12)7(14)6(13)3-4/h2-3H,1H3,(H3,15,16,17,18,19) |
| InChIKey | DTXRCQRMDYBEKF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|