About methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate
methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate (PubChem CID 146317201) has the molecular formula C12H12FN5O2
and a molecular weight of 277.26 g/mol. Its IUPAC name is methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate |
| PubChem CID | 146317201 |
| Molecular Formula | C12H12FN5O2 |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate |
| SMILES | COC(=O)c1nc(N)nc(N(C)c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H12FN5O2/c1-18(8-5-3-7(13)4-6-8)12-16-9(10(19)20-2)15-11(14)17-12/h3-6H,1-2H3,(H2,14,15,16,17) |
| InChIKey | WKMNWHJGYAOGBJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate?
The IUPAC name of methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate (CID 146317201) is methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate.
What is the SMILES notation for methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate?
The canonical SMILES for methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate is COC(=O)c1nc(N)nc(N(C)c2ccc(F)cc2)n1.
What is the InChIKey of methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate?
The InChIKey is WKMNWHJGYAOGBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FN5O2/c1-18(8-5-3-7(13)4-6-8)12-16-9(10(19)20-2)15-11(14)17-12/h3-6H,1-2H3,(H2,14,15,16,17).
What are the key properties of methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate?
methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate has a molecular weight of 277.26 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-6-(4-fluoro-N-methylanilino)-1,3,5-triazine-2-carboxylate is sourced from PubChem (CID 146317201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).