C25H24FN5O4 — CID 146317222
(5S)-5-[5-[2-fluoro-4-(1,3-oxazol-2-yl)phenyl]-1H-imidazol-2-yl]-5-[6-(1,2-oxazol-3-yl)-6-oxohexyl]pyrrolidin-2-one (PubChem CID 146317222) has the molecular formula C25H24FN5O4 and a molecular weight of 477.50 g/mol. Its IUPAC name is (5S)-5-[5-[2-fluoro-4-(1,3-oxazol-2-yl)phenyl]-1H-imidazol-2-yl]-5-[6-(1,2-oxazol-3-yl)-6-oxohexyl]pyrrolidin-2-one.
| Compound Name | (5S)-5-[5-[2-fluoro-4-(1,3-oxazol-2-yl)phenyl]-1H-imidazol-2-yl]-5-[6-(1,2-oxazol-3-yl)-6-oxohexyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 146317222 |
| Molecular Formula | C25H24FN5O4 |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | (5S)-5-[5-[2-fluoro-4-(1,3-oxazol-2-yl)phenyl]-1H-imidazol-2-yl]-5-[6-(1,2-oxazol-3-yl)-6-oxohexyl]pyrrolidin-2-one |
| SMILES | O=C1CC[C@@](CCCCCC(=O)c2ccon2)(c2ncc(-c3ccc(-c4ncco4)cc3F)[nH]2)N1 |
| InChI | InChI=1S/C25H24FN5O4/c26-18-14-16(23-27-11-13-34-23)5-6-17(18)20-15-28-24(29-20)25(10-7-22(33)30-25)9-3-1-2-4-21(32)19-8-12-35-31-19/h5-6,8,11-15H,1-4,7,9-10H2,(H,28,29)(H,30,33)/t25-/m0/s1 |
| InChIKey | NNALPVDZCZUKHU-VWLOTQADSA-N |
| XLogP | 4.80 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|