C21H21FN4O4 — CID 146317383
4-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-4-[6-(1,3-oxazol-2-yl)-6-oxohexyl]-1,3-oxazolidin-2-one (PubChem CID 146317383) has the molecular formula C21H21FN4O4 and a molecular weight of 412.42 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-4-[6-(1,3-oxazol-2-yl)-6-oxohexyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-4-[6-(1,3-oxazol-2-yl)-6-oxohexyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 146317383 |
| Molecular Formula | C21H21FN4O4 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-1H-imidazol-2-yl]-4-[6-(1,3-oxazol-2-yl)-6-oxohexyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(CCCCCC(=O)c2ncco2)(c2ncc(-c3ccc(F)cc3)[nH]2)CO1 |
| InChI | InChI=1S/C21H21FN4O4/c22-15-7-5-14(6-8-15)16-12-24-19(25-16)21(13-30-20(28)26-21)9-3-1-2-4-17(27)18-23-10-11-29-18/h5-8,10-12H,1-4,9,13H2,(H,24,25)(H,26,28) |
| InChIKey | CNMFASOGWRJWDV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 110.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|