About 4-amino-2-fluorobenzonitrile;dihydrofluoride
4-amino-2-fluorobenzonitrile;dihydrofluoride (PubChem CID 146317579) has the molecular formula C7H7F3N2
and a molecular weight of 176.14 g/mol. Its IUPAC name is 4-amino-2-fluorobenzonitrile;dihydrofluoride.
Molecular Properties
| Compound Name | 4-amino-2-fluorobenzonitrile;dihydrofluoride |
| PubChem CID | 146317579 |
| Molecular Formula | C7H7F3N2 |
| Molecular Weight | 176.14 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 4-amino-2-fluorobenzonitrile;dihydrofluoride |
| SMILES | F.F.N#Cc1ccc(N)cc1F |
| InChI | InChI=1S/C7H5FN2.2FH/c8-7-3-6(10)2-1-5(7)4-9;;/h1-3H,10H2;2*1H |
| InChIKey | WRPARQKKAWCRSS-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.14 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-fluorobenzonitrile;dihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-fluorobenzonitrile;dihydrofluoride?
The IUPAC name of 4-amino-2-fluorobenzonitrile;dihydrofluoride (CID 146317579) is 4-amino-2-fluorobenzonitrile;dihydrofluoride.
What is the SMILES notation for 4-amino-2-fluorobenzonitrile;dihydrofluoride?
The canonical SMILES for 4-amino-2-fluorobenzonitrile;dihydrofluoride is F.F.N#Cc1ccc(N)cc1F.
What is the InChIKey of 4-amino-2-fluorobenzonitrile;dihydrofluoride?
The InChIKey is WRPARQKKAWCRSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5FN2.2FH/c8-7-3-6(10)2-1-5(7)4-9;;/h1-3H,10H2;2*1H.
What are the key properties of 4-amino-2-fluorobenzonitrile;dihydrofluoride?
4-amino-2-fluorobenzonitrile;dihydrofluoride has a molecular weight of 176.14 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-fluorobenzonitrile;dihydrofluoride is sourced from PubChem (CID 146317579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).