About (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine
(Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine (PubChem CID 146317720) has the molecular formula C10H10Cl2FNO2S
and a molecular weight of 298.17 g/mol. Its IUPAC name is (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine |
| PubChem CID | 146317720 |
| Molecular Formula | C10H10Cl2FNO2S |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine |
| SMILES | NC/C=C(\F)CS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H10Cl2FNO2S/c11-7-3-8(12)5-10(4-7)17(15,16)6-9(13)1-2-14/h1,3-5H,2,6,14H2/b9-1- |
| InChIKey | HAQANZMXSDQBCH-OQYWKCLKSA-N |
| XLogP | 2.58 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine?
The IUPAC name of (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine (CID 146317720) is (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine.
What is the SMILES notation for (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine?
The canonical SMILES for (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine is NC/C=C(\F)CS(=O)(=O)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine?
The InChIKey is HAQANZMXSDQBCH-OQYWKCLKSA-N. The full InChI is InChI=1S/C10H10Cl2FNO2S/c11-7-3-8(12)5-10(4-7)17(15,16)6-9(13)1-2-14/h1,3-5H,2,6,14H2/b9-1-.
What are the key properties of (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine?
(Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine has a molecular weight of 298.17 g/mol, XLogP of 2.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(3,5-dichlorophenyl)sulfonyl-3-fluorobut-2-en-1-amine is sourced from PubChem (CID 146317720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).