C10H15Cl2FN2O2S — CID 146317822
(Z)-3-fluoro-4-[(4-methyl-3-pyridinyl)sulfonyl]but-2-en-1-amine;dihydrochloride (PubChem CID 146317822) has the molecular formula C10H15Cl2FN2O2S and a molecular weight of 317.21 g/mol. Its IUPAC name is (Z)-3-fluoro-4-[(4-methyl-3-pyridinyl)sulfonyl]but-2-en-1-amine;dihydrochloride.
| Compound Name | (Z)-3-fluoro-4-[(4-methyl-3-pyridinyl)sulfonyl]but-2-en-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 146317822 |
| Molecular Formula | C10H15Cl2FN2O2S |
| Molecular Weight | 317.21 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (Z)-3-fluoro-4-[(4-methyl-3-pyridinyl)sulfonyl]but-2-en-1-amine;dihydrochloride |
| SMILES | Cc1ccncc1S(=O)(=O)C/C(F)=C/CN.Cl.Cl |
| InChI | InChI=1S/C10H13FN2O2S.2ClH/c1-8-3-5-13-6-10(8)16(14,15)7-9(11)2-4-12;;/h2-3,5-6H,4,7,12H2,1H3;2*1H/b9-2-;; |
| InChIKey | DDGYFCHTRVRICC-QKPIXOABSA-N |
| XLogP | 1.82 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |