About N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine
N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine (PubChem CID 146317975) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
Analyze N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine?
The IUPAC name of N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine (CID 146317975) is N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine.
What is the SMILES notation for N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine?
The canonical SMILES for N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine is CNc1ccc2ncnn2c1C.
What is the InChIKey of N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine?
The InChIKey is OWKNJBVKFQOMEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-6-7(9-2)3-4-8-10-5-11-12(6)8/h3-5,9H,1-2H3.
What are the key properties of N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine?
N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine has a molecular weight of 162.20 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-dimethyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine is sourced from PubChem (CID 146317975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).