C18H34N2O — CID 146318179
(3Z,5Z,7Z)-2,3-dimethyl-7-[2-(methylamino)ethoxy]-5-propan-2-yldeca-3,5,7-trien-4-amine (PubChem CID 146318179) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is (3Z,5Z,7Z)-2,3-dimethyl-7-[2-(methylamino)ethoxy]-5-propan-2-yldeca-3,5,7-trien-4-amine.
| Compound Name | (3Z,5Z,7Z)-2,3-dimethyl-7-[2-(methylamino)ethoxy]-5-propan-2-yldeca-3,5,7-trien-4-amine |
|---|---|
| PubChem CID | 146318179 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | (3Z,5Z,7Z)-2,3-dimethyl-7-[2-(methylamino)ethoxy]-5-propan-2-yldeca-3,5,7-trien-4-amine |
| SMILES | CC/C=C(/C=C(C(\N)=C(/C)C(C)C)/C(C)C)OCCNC |
| InChI | InChI=1S/C18H34N2O/c1-8-9-16(21-11-10-20-7)12-17(14(4)5)18(19)15(6)13(2)3/h9,12-14,20H,8,10-11,19H2,1-7H3/b16-9-,17-12-,18-15- |
| InChIKey | UMCXBDJNFDATPV-KSGQYQEVSA-N |
| XLogP | 3.99 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|