About 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine
1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine (PubChem CID 146318277) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine.
Molecular Properties
| Compound Name | 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine |
| PubChem CID | 146318277 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine |
| SMILES | C=C(/C=C\CN(C)N)C(C)(C)C |
| InChI | InChI=1S/C10H20N2/c1-9(10(2,3)4)7-6-8-12(5)11/h6-7H,1,8,11H2,2-5H3/b7-6- |
| InChIKey | NHHLJFGFCSBVBT-SREVYHEPSA-N |
| XLogP | 1.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine?
The IUPAC name of 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine (CID 146318277) is 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine.
What is the SMILES notation for 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine?
The canonical SMILES for 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine is C=C(/C=C\CN(C)N)C(C)(C)C.
What is the InChIKey of 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine?
The InChIKey is NHHLJFGFCSBVBT-SREVYHEPSA-N. The full InChI is InChI=1S/C10H20N2/c1-9(10(2,3)4)7-6-8-12(5)11/h6-7H,1,8,11H2,2-5H3/b7-6-.
What are the key properties of 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine?
1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine has a molecular weight of 168.28 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-5,5-dimethyl-4-methylidenehex-2-enyl]-1-methylhydrazine is sourced from PubChem (CID 146318277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).