About 2H-1,2-benzothiazine;1,10-phenanthroline
2H-1,2-benzothiazine;1,10-phenanthroline (PubChem CID 146319170) has the molecular formula C20H15N3S
and a molecular weight of 329.43 g/mol. Its IUPAC name is 2H-1,2-benzothiazine;1,10-phenanthroline.
Molecular Properties
| Compound Name | 2H-1,2-benzothiazine;1,10-phenanthroline |
| PubChem CID | 146319170 |
| Molecular Formula | C20H15N3S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2H-1,2-benzothiazine;1,10-phenanthroline |
| SMILES | C1=Cc2ccccc2SN1.c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.C8H7NS/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;1-2-4-8-7(3-1)5-6-9-10-8/h1-8H;1-6,9H |
| InChIKey | SQZHVUFTJLACIS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2H-1,2-benzothiazine;1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,2-benzothiazine;1,10-phenanthroline?
The IUPAC name of 2H-1,2-benzothiazine;1,10-phenanthroline (CID 146319170) is 2H-1,2-benzothiazine;1,10-phenanthroline.
What is the SMILES notation for 2H-1,2-benzothiazine;1,10-phenanthroline?
The canonical SMILES for 2H-1,2-benzothiazine;1,10-phenanthroline is C1=Cc2ccccc2SN1.c1cnc2c(c1)ccc1cccnc12.
What is the InChIKey of 2H-1,2-benzothiazine;1,10-phenanthroline?
The InChIKey is SQZHVUFTJLACIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2.C8H7NS/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;1-2-4-8-7(3-1)5-6-9-10-8/h1-8H;1-6,9H.
What are the key properties of 2H-1,2-benzothiazine;1,10-phenanthroline?
2H-1,2-benzothiazine;1,10-phenanthroline has a molecular weight of 329.43 g/mol, XLogP of 5.05, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,2-benzothiazine;1,10-phenanthroline is sourced from PubChem (CID 146319170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).