C18H32O3S — CID 146319185
3,3-dihexylcyclohexa-1,4-diene-1-sulfonic acid (PubChem CID 146319185) has the molecular formula C18H32O3S and a molecular weight of 328.52 g/mol. Its IUPAC name is 3,3-dihexylcyclohexa-1,4-diene-1-sulfonic acid.
| Compound Name | 3,3-dihexylcyclohexa-1,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 146319185 |
| Molecular Formula | C18H32O3S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 3,3-dihexylcyclohexa-1,4-diene-1-sulfonic acid |
| SMILES | CCCCCCC1(CCCCCC)C=CCC(S(=O)(=O)O)=C1 |
| InChI | InChI=1S/C18H32O3S/c1-3-5-7-9-13-18(14-10-8-6-4-2)15-11-12-17(16-18)22(19,20)21/h11,15-16H,3-10,12-14H2,1-2H3,(H,19,20,21) |
| InChIKey | YGSGTRPZYLGLNK-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|