C20H24N2O3 — CID 146319555
(3'aS,5'aR,9'aR)-5'a-methoxyspiro[1H-indole-3,3'-2,3a,4,5,6,7,9,9a-octahydro-1H-pyrrolo[1,2-a]quinoline]-2,8'-dione (PubChem CID 146319555) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (3'aS,5'aR,9'aR)-5'a-methoxyspiro[1H-indole-3,3'-2,3a,4,5,6,7,9,9a-octahydro-1H-pyrrolo[1,2-a]quinoline]-2,8'-dione.
| Compound Name | (3'aS,5'aR,9'aR)-5'a-methoxyspiro[1H-indole-3,3'-2,3a,4,5,6,7,9,9a-octahydro-1H-pyrrolo[1,2-a]quinoline]-2,8'-dione |
|---|---|
| PubChem CID | 146319555 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (3'aS,5'aR,9'aR)-5'a-methoxyspiro[1H-indole-3,3'-2,3a,4,5,6,7,9,9a-octahydro-1H-pyrrolo[1,2-a]quinoline]-2,8'-dione |
| SMILES | CO[C@]12CCC(=O)C[C@H]1N1CCC3(C(=O)Nc4ccccc43)[C@@H]1CC2 |
| InChI | InChI=1S/C20H24N2O3/c1-25-19-8-6-13(23)12-17(19)22-11-10-20(16(22)7-9-19)14-4-2-3-5-15(14)21-18(20)24/h2-5,16-17H,6-12H2,1H3,(H,21,24)/t16-,17+,19-,20?/m0/s1 |
| InChIKey | AXWXEEMCCKBALE-ZCQXEVHSSA-N |
| XLogP | 2.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |