C24H24N4O4 — CID 146320867
butyl 3-[[5-(4-cyano-3-methoxyphenyl)pyrimidin-2-yl]amino]-4-methoxybenzoate (PubChem CID 146320867) has the molecular formula C24H24N4O4 and a molecular weight of 432.48 g/mol. Its IUPAC name is butyl 3-[[5-(4-cyano-3-methoxyphenyl)pyrimidin-2-yl]amino]-4-methoxybenzoate.
| Compound Name | butyl 3-[[5-(4-cyano-3-methoxyphenyl)pyrimidin-2-yl]amino]-4-methoxybenzoate |
|---|---|
| PubChem CID | 146320867 |
| Molecular Formula | C24H24N4O4 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | butyl 3-[[5-(4-cyano-3-methoxyphenyl)pyrimidin-2-yl]amino]-4-methoxybenzoate |
| SMILES | CCCCOC(=O)c1ccc(OC)c(Nc2ncc(-c3ccc(C#N)c(OC)c3)cn2)c1 |
| InChI | InChI=1S/C24H24N4O4/c1-4-5-10-32-23(29)17-8-9-21(30-2)20(11-17)28-24-26-14-19(15-27-24)16-6-7-18(13-25)22(12-16)31-3/h6-9,11-12,14-15H,4-5,10H2,1-3H3,(H,26,27,28) |
| InChIKey | XOMJLCOZVLHVSK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 106.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|