About (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane
(5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane (PubChem CID 146320979) has the molecular formula C9H13BrN2
and a molecular weight of 229.12 g/mol. Its IUPAC name is (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane.
Molecular Properties
| Compound Name | (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane |
| PubChem CID | 146320979 |
| Molecular Formula | C9H13BrN2 |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane |
| SMILES | C=C(Br)/C=C1/CCNC(=C)CN1 |
| InChI | InChI=1S/C9H13BrN2/c1-7(10)5-9-3-4-11-8(2)6-12-9/h5,11-12H,1-4,6H2/b9-5- |
| InChIKey | PSJQKPSDQYKNNI-UITAMQMPSA-N |
| XLogP | 1.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane?
The IUPAC name of (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane (CID 146320979) is (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane.
What is the SMILES notation for (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane?
The canonical SMILES for (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane is C=C(Br)/C=C1/CCNC(=C)CN1.
What is the InChIKey of (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane?
The InChIKey is PSJQKPSDQYKNNI-UITAMQMPSA-N. The full InChI is InChI=1S/C9H13BrN2/c1-7(10)5-9-3-4-11-8(2)6-12-9/h5,11-12H,1-4,6H2/b9-5-.
What are the key properties of (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane?
(5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane has a molecular weight of 229.12 g/mol, XLogP of 1.88, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-(2-bromoprop-2-enylidene)-2-methylidene-1,4-diazepane is sourced from PubChem (CID 146320979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).