C20H26ClN3OS — CID 146321386
N-[(5-chloro-2-methoxyphenyl)sulfanylmethyl]-4-[(4-methylpiperazin-1-yl)methyl]aniline (PubChem CID 146321386) has the molecular formula C20H26ClN3OS and a molecular weight of 391.97 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)sulfanylmethyl]-4-[(4-methylpiperazin-1-yl)methyl]aniline.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)sulfanylmethyl]-4-[(4-methylpiperazin-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 146321386 |
| Molecular Formula | C20H26ClN3OS |
| Molecular Weight | 391.97 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)sulfanylmethyl]-4-[(4-methylpiperazin-1-yl)methyl]aniline |
| SMILES | COc1ccc(Cl)cc1SCNc1ccc(CN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H26ClN3OS/c1-23-9-11-24(12-10-23)14-16-3-6-18(7-4-16)22-15-26-20-13-17(21)5-8-19(20)25-2/h3-8,13,22H,9-12,14-15H2,1-2H3 |
| InChIKey | JPZRRFLGRNEXKO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.97 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|