About 2-cyclobutyl-N'-ethenylethanimidamide
2-cyclobutyl-N'-ethenylethanimidamide (PubChem CID 146321464) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is 2-cyclobutyl-N'-ethenylethanimidamide.
Molecular Properties
| Compound Name | 2-cyclobutyl-N'-ethenylethanimidamide |
| PubChem CID | 146321464 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 2-cyclobutyl-N'-ethenylethanimidamide |
| SMILES | C=C/N=C(\N)CC1CCC1 |
| InChI | InChI=1S/C8H14N2/c1-2-10-8(9)6-7-4-3-5-7/h2,7H,1,3-6H2,(H2,9,10) |
| InChIKey | GZXZYAMLONUVFZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclobutyl-N'-ethenylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyl-N'-ethenylethanimidamide?
The IUPAC name of 2-cyclobutyl-N'-ethenylethanimidamide (CID 146321464) is 2-cyclobutyl-N'-ethenylethanimidamide.
What is the SMILES notation for 2-cyclobutyl-N'-ethenylethanimidamide?
The canonical SMILES for 2-cyclobutyl-N'-ethenylethanimidamide is C=C/N=C(\N)CC1CCC1.
What is the InChIKey of 2-cyclobutyl-N'-ethenylethanimidamide?
The InChIKey is GZXZYAMLONUVFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-2-10-8(9)6-7-4-3-5-7/h2,7H,1,3-6H2,(H2,9,10).
What are the key properties of 2-cyclobutyl-N'-ethenylethanimidamide?
2-cyclobutyl-N'-ethenylethanimidamide has a molecular weight of 138.21 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-N'-ethenylethanimidamide is sourced from PubChem (CID 146321464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).