About (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol
(2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol (PubChem CID 146321512) has the molecular formula C13H24N2O
and a molecular weight of 224.35 g/mol. Its IUPAC name is (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol.
Molecular Properties
| Compound Name | (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol |
| PubChem CID | 146321512 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol |
| SMILES | C/C=C(O)\C(=C/CC)CN1CCN(C)CC1 |
| InChI | InChI=1S/C13H24N2O/c1-4-6-12(13(16)5-2)11-15-9-7-14(3)8-10-15/h5-6,16H,4,7-11H2,1-3H3/b12-6-,13-5+ |
| InChIKey | HIAQHKTWDNLWEG-VKQOEWNXSA-N |
| XLogP | 2.03 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol?
The IUPAC name of (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol (CID 146321512) is (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol.
What is the SMILES notation for (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol?
The canonical SMILES for (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol is C/C=C(O)\C(=C/CC)CN1CCN(C)CC1.
What is the InChIKey of (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol?
The InChIKey is HIAQHKTWDNLWEG-VKQOEWNXSA-N. The full InChI is InChI=1S/C13H24N2O/c1-4-6-12(13(16)5-2)11-15-9-7-14(3)8-10-15/h5-6,16H,4,7-11H2,1-3H3/b12-6-,13-5+.
What are the key properties of (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol?
(2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol has a molecular weight of 224.35 g/mol, XLogP of 2.03, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-4-[(4-methylpiperazin-1-yl)methyl]hepta-2,4-dien-3-ol is sourced from PubChem (CID 146321512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).