C21H25NS — CID 146321672
8-[(3Z,5Z)-3,6,7-trimethylocta-1,3,5-trienyl]sulfanyl-9aH-cyclohepta[b]pyridine (PubChem CID 146321672) has the molecular formula C21H25NS and a molecular weight of 323.51 g/mol. Its IUPAC name is 8-[(3Z,5Z)-3,6,7-trimethylocta-1,3,5-trienyl]sulfanyl-9aH-cyclohepta[b]pyridine.
| Compound Name | 8-[(3Z,5Z)-3,6,7-trimethylocta-1,3,5-trienyl]sulfanyl-9aH-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 146321672 |
| Molecular Formula | C21H25NS |
| Molecular Weight | 323.51 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 8-[(3Z,5Z)-3,6,7-trimethylocta-1,3,5-trienyl]sulfanyl-9aH-cyclohepta[b]pyridine |
| SMILES | C/C(C=CSC1=CC2N=CC=CC2=CC=C1)=C/C=C(/C)C(C)C |
| InChI | InChI=1S/C21H25NS/c1-16(2)18(4)11-10-17(3)12-14-23-20-9-5-7-19-8-6-13-22-21(19)15-20/h5-16,21H,1-4H3/b14-12?,17-10-,18-11- |
| InChIKey | NSFDJRPYBLXBRP-LMGGAPCTSA-N |
| XLogP | 6.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|