C13H20N2 — CID 146321691
(Z,2Z)-N'-methylidene-2-[(Z)-pent-3-en-2-ylidene]hept-6-ene-1,7-diimine (PubChem CID 146321691) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is (Z,2Z)-N'-methylidene-2-[(Z)-pent-3-en-2-ylidene]hept-6-ene-1,7-diimine.
| Compound Name | (Z,2Z)-N'-methylidene-2-[(Z)-pent-3-en-2-ylidene]hept-6-ene-1,7-diimine |
|---|---|
| PubChem CID | 146321691 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | (Z,2Z)-N'-methylidene-2-[(Z)-pent-3-en-2-ylidene]hept-6-ene-1,7-diimine |
| SMILES | [H]/N=C/C(CCC/C=C\N=C)=C(C)\C=C/C |
| InChI | InChI=1S/C13H20N2/c1-4-8-12(2)13(11-14)9-6-5-7-10-15-3/h4,7-8,10-11,14H,3,5-6,9H2,1-2H3/b8-4-,10-7-,13-12-,14-11+ |
| InChIKey | AEPMMFUKCWUTBI-SZDCYGOPSA-N |
| XLogP | 3.91 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|