C31H36F2N6O2 — CID 146322257
(3S)-4-(3,3-difluorocyclobutyl)-6-[5-[(3S,5R)-3,5-dimethylpiperazine-1-carbonyl]-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,3-dimethyl-3,4-dihydroquinolin-2-one (PubChem CID 146322257) has the molecular formula C31H36F2N6O2 and a molecular weight of 562.67 g/mol. Its IUPAC name is (3S)-4-(3,3-difluorocyclobutyl)-6-[5-[(3S,5R)-3,5-dimethylpiperazine-1-carbonyl]-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,3-dimethyl-3,4-dihydroquinolin-2-one.
| Compound Name | (3S)-4-(3,3-difluorocyclobutyl)-6-[5-[(3S,5R)-3,5-dimethylpiperazine-1-carbonyl]-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,3-dimethyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 146322257 |
| Molecular Formula | C31H36F2N6O2 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | (3S)-4-(3,3-difluorocyclobutyl)-6-[5-[(3S,5R)-3,5-dimethylpiperazine-1-carbonyl]-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,3-dimethyl-3,4-dihydroquinolin-2-one |
| SMILES | Cc1ccc(-n2nc(C(=O)N3C[C@@H](C)N[C@@H](C)C3)nc2-c2ccc3c(c2)C(C2CC(F)(F)C2)[C@H](C)C(=O)N3C)cc1 |
| InChI | InChI=1S/C31H36F2N6O2/c1-17-6-9-23(10-7-17)39-28(35-27(36-39)30(41)38-15-18(2)34-19(3)16-38)21-8-11-25-24(12-21)26(20(4)29(40)37(25)5)22-13-31(32,33)14-22/h6-12,18-20,22,26,34H,13-16H2,1-5H3/t18-,19+,20-,26?/m0/s1 |
| InChIKey | HSDCSFYTERPKDD-ZPCXWSFCSA-N |
| XLogP | 4.81 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |