C29H35N7O3 — CID 146322259
(3R)-6-[5-[(3R,5S)-3,5-dimethylpiperazine-1-carbonyl]-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,3-dimethyl-4-(oxetan-3-yl)-3H-quinoxalin-2-one (PubChem CID 146322259) has the molecular formula C29H35N7O3 and a molecular weight of 529.65 g/mol. Its IUPAC name is (3R)-6-[5-[(3R,5S)-3,5-dimethylpiperazine-1-carbonyl]-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,3-dimethyl-4-(oxetan-3-yl)-3H-quinoxalin-2-one.
| Compound Name | (3R)-6-[5-[(3R,5S)-3,5-dimethylpiperazine-1-carbonyl]-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,3-dimethyl-4-(oxetan-3-yl)-3H-quinoxalin-2-one |
|---|---|
| PubChem CID | 146322259 |
| Molecular Formula | C29H35N7O3 |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | (3R)-6-[5-[(3R,5S)-3,5-dimethylpiperazine-1-carbonyl]-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,3-dimethyl-4-(oxetan-3-yl)-3H-quinoxalin-2-one |
| SMILES | Cc1ccc(-n2nc(C(=O)N3C[C@@H](C)N[C@@H](C)C3)nc2-c2ccc3c(c2)N(C2COC2)[C@H](C)C(=O)N3C)cc1 |
| InChI | InChI=1S/C29H35N7O3/c1-17-6-9-22(10-7-17)36-27(31-26(32-36)29(38)34-13-18(2)30-19(3)14-34)21-8-11-24-25(12-21)35(23-15-39-16-23)20(4)28(37)33(24)5/h6-12,18-20,23,30H,13-16H2,1-5H3/t18-,19+,20-/m1/s1 |
| InChIKey | UHYZGGBEVXTMTI-HSALFYBXSA-N |
| XLogP | 2.64 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |