C31H39N7O2 — CID 146322270
(3R)-4-cyclopentyl-6-[5-[(3S,5R)-3,5-dimethylpiperazine-1-carbonyl]-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,3-dimethyl-3H-quinoxalin-2-one (PubChem CID 146322270) has the molecular formula C31H39N7O2 and a molecular weight of 541.70 g/mol. Its IUPAC name is (3R)-4-cyclopentyl-6-[5-[(3S,5R)-3,5-dimethylpiperazine-1-carbonyl]-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,3-dimethyl-3H-quinoxalin-2-one.
| Compound Name | (3R)-4-cyclopentyl-6-[5-[(3S,5R)-3,5-dimethylpiperazine-1-carbonyl]-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,3-dimethyl-3H-quinoxalin-2-one |
|---|---|
| PubChem CID | 146322270 |
| Molecular Formula | C31H39N7O2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | (3R)-4-cyclopentyl-6-[5-[(3S,5R)-3,5-dimethylpiperazine-1-carbonyl]-2-(4-methylphenyl)-1,2,4-triazol-3-yl]-1,3-dimethyl-3H-quinoxalin-2-one |
| SMILES | Cc1ccc(-n2nc(C(=O)N3C[C@@H](C)N[C@@H](C)C3)nc2-c2ccc3c(c2)N(C2CCCC2)[C@H](C)C(=O)N3C)cc1 |
| InChI | InChI=1S/C31H39N7O2/c1-19-10-13-25(14-11-19)38-29(33-28(34-38)31(40)36-17-20(2)32-21(3)18-36)23-12-15-26-27(16-23)37(24-8-6-7-9-24)22(4)30(39)35(26)5/h10-16,20-22,24,32H,6-9,17-18H2,1-5H3/t20-,21+,22-/m1/s1 |
| InChIKey | RCVYHIHRLZXFNV-BHIFYINESA-N |
| XLogP | 4.18 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |