C24H23NO5S — CID 146322354
(17-hydroxy-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9,15-tetraen-18-yl) 2-phenylsulfanylacetate (PubChem CID 146322354) has the molecular formula C24H23NO5S and a molecular weight of 437.52 g/mol. Its IUPAC name is (17-hydroxy-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9,15-tetraen-18-yl) 2-phenylsulfanylacetate.
| Compound Name | (17-hydroxy-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9,15-tetraen-18-yl) 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 146322354 |
| Molecular Formula | C24H23NO5S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (17-hydroxy-5,7-dioxa-12-azapentacyclo[10.6.1.02,10.04,8.015,19]nonadeca-2,4(8),9,15-tetraen-18-yl) 2-phenylsulfanylacetate |
| SMILES | O=C(CSc1ccccc1)OC1C(O)C=C2CCN3Cc4cc5c(cc4C1C23)OCO5 |
| InChI | InChI=1S/C24H23NO5S/c26-18-8-14-6-7-25-11-15-9-19-20(29-13-28-19)10-17(15)22(23(14)25)24(18)30-21(27)12-31-16-4-2-1-3-5-16/h1-5,8-10,18,22-24,26H,6-7,11-13H2 |
| InChIKey | PMTVXLSFJHVFPI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|