C14H21F3OS — CID 14632250
3-[(3E)-4,8-dimethylnona-3,7-dienyl]sulfanyl-1,1,1-trifluoropropan-2-one (PubChem CID 14632250) has the molecular formula C14H21F3OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-[(3E)-4,8-dimethylnona-3,7-dienyl]sulfanyl-1,1,1-trifluoropropan-2-one.
| Compound Name | 3-[(3E)-4,8-dimethylnona-3,7-dienyl]sulfanyl-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 14632250 |
| Molecular Formula | C14H21F3OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 3-[(3E)-4,8-dimethylnona-3,7-dienyl]sulfanyl-1,1,1-trifluoropropan-2-one |
| SMILES | CC(C)=CCC/C(C)=C/CCSCC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H21F3OS/c1-11(2)6-4-7-12(3)8-5-9-19-10-13(18)14(15,16)17/h6,8H,4-5,7,9-10H2,1-3H3/b12-8+ |
| InChIKey | AUGRLLDMSFTFTC-XYOKQWHBSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|