About 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine
2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine (PubChem CID 146322593) has the molecular formula C16H31F2N
and a molecular weight of 275.43 g/mol. Its IUPAC name is 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine.
Molecular Properties
| Compound Name | 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine |
| PubChem CID | 146322593 |
| Molecular Formula | C16H31F2N |
| Molecular Weight | 275.43 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine |
| SMILES | CNC(C(C)C)C(C)C1CCC(C(C)(F)F)C(C)C1 |
| InChI | InChI=1S/C16H31F2N/c1-10(2)15(19-6)12(4)13-7-8-14(11(3)9-13)16(5,17)18/h10-15,19H,7-9H2,1-6H3 |
| InChIKey | ODAQCIBRFZHEFC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine?
The IUPAC name of 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine (CID 146322593) is 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine.
What is the SMILES notation for 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine?
The canonical SMILES for 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine is CNC(C(C)C)C(C)C1CCC(C(C)(F)F)C(C)C1.
What is the InChIKey of 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine?
The InChIKey is ODAQCIBRFZHEFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31F2N/c1-10(2)15(19-6)12(4)13-7-8-14(11(3)9-13)16(5,17)18/h10-15,19H,7-9H2,1-6H3.
What are the key properties of 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine?
2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine has a molecular weight of 275.43 g/mol, XLogP of 4.57, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1,1-difluoroethyl)-3-methylcyclohexyl]-N,4-dimethylpentan-3-amine is sourced from PubChem (CID 146322593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).