About 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one
3-acetyl-4-hydroxy-6,6-dimethylthian-2-one (PubChem CID 146322679) has the molecular formula C9H14O3S
and a molecular weight of 202.27 g/mol. Its IUPAC name is 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one.
Molecular Properties
| Compound Name | 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one |
| PubChem CID | 146322679 |
| Molecular Formula | C9H14O3S |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one |
| SMILES | CC(=O)C1C(=O)SC(C)(C)CC1O |
| InChI | InChI=1S/C9H14O3S/c1-5(10)7-6(11)4-9(2,3)13-8(7)12/h6-7,11H,4H2,1-3H3 |
| InChIKey | KLXQCXDKOPMKKC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one?
The IUPAC name of 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one (CID 146322679) is 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one.
What is the SMILES notation for 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one?
The canonical SMILES for 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one is CC(=O)C1C(=O)SC(C)(C)CC1O.
What is the InChIKey of 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one?
The InChIKey is KLXQCXDKOPMKKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3S/c1-5(10)7-6(11)4-9(2,3)13-8(7)12/h6-7,11H,4H2,1-3H3.
What are the key properties of 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one?
3-acetyl-4-hydroxy-6,6-dimethylthian-2-one has a molecular weight of 202.27 g/mol, XLogP of 0.99, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-4-hydroxy-6,6-dimethylthian-2-one is sourced from PubChem (CID 146322679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).