C23H37N5O11 — CID 146322773
2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]butylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid (PubChem CID 146322773) has the molecular formula C23H37N5O11 and a molecular weight of 559.57 g/mol. Its IUPAC name is 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]butylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]butylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 146322773 |
| Molecular Formula | C23H37N5O11 |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[4-[methyl-[(Z)-4-oxobut-2-enoyl]amino]butylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | CN(CCCCNC(=O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C23H37N5O11/c1-25(19(31)5-4-12-29)7-3-2-6-24-18(30)13-26(8-10-27(14-20(32)33)15-21(34)35)9-11-28(16-22(36)37)17-23(38)39/h4-5,12H,2-3,6-11,13-17H2,1H3,(H,24,30)(H,32,33)(H,34,35)(H,36,37)(H,38,39)/b5-4- |
| InChIKey | LOKJTTJUCPPHNJ-PLNGDYQASA-N |
| XLogP | -2.66 |
| TPSA | 225.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|