C23H37N5O11 — CID 146322839
2-[2-[carboxymethyl(2,2-dihydroxyethyl)amino]ethyl-[2-[carboxymethyl-[2-[5-(2,5-dioxopyrrol-1-yl)pentylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid (PubChem CID 146322839) has the molecular formula C23H37N5O11 and a molecular weight of 559.57 g/mol. Its IUPAC name is 2-[2-[carboxymethyl(2,2-dihydroxyethyl)amino]ethyl-[2-[carboxymethyl-[2-[5-(2,5-dioxopyrrol-1-yl)pentylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[2-[carboxymethyl(2,2-dihydroxyethyl)amino]ethyl-[2-[carboxymethyl-[2-[5-(2,5-dioxopyrrol-1-yl)pentylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 146322839 |
| Molecular Formula | C23H37N5O11 |
| Molecular Weight | 559.57 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | 2-[2-[carboxymethyl(2,2-dihydroxyethyl)amino]ethyl-[2-[carboxymethyl-[2-[5-(2,5-dioxopyrrol-1-yl)pentylamino]-2-oxoethyl]amino]ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)NCCCCCN1C(=O)C=CC1=O)CCN(CC(=O)O)CC(O)O |
| InChI | InChI=1S/C23H37N5O11/c29-17(24-6-2-1-3-7-28-18(30)4-5-19(28)31)12-26(14-21(34)35)10-8-25(13-20(32)33)9-11-27(15-22(36)37)16-23(38)39/h4-5,22,36-37H,1-3,6-16H2,(H,24,29)(H,32,33)(H,34,35)(H,38,39) |
| InChIKey | LYSKWQDJHMAKMF-UHFFFAOYSA-N |
| XLogP | -3.33 |
| TPSA | 228.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.57 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|