C25H41N5O11 — CID 146322850
2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid (PubChem CID 146322850) has the molecular formula C25H41N5O11 and a molecular weight of 587.63 g/mol. Its IUPAC name is 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 146322850 |
| Molecular Formula | C25H41N5O11 |
| Molecular Weight | 587.63 g/mol |
| Exact Mass | 587.28 |
| IUPAC Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-[6-[methyl-[(Z)-4-oxobut-2-enoyl]amino]hexylamino]-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | CN(CCCCCCNC(=O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)O)C(=O)/C=C\C=O |
| InChI | InChI=1S/C25H41N5O11/c1-27(21(33)7-6-14-31)9-5-3-2-4-8-26-20(32)15-28(10-12-29(16-22(34)35)17-23(36)37)11-13-30(18-24(38)39)19-25(40)41/h6-7,14H,2-5,8-13,15-19H2,1H3,(H,26,32)(H,34,35)(H,36,37)(H,38,39)(H,40,41)/b7-6- |
| InChIKey | RWJQLTRMXJMKIW-SREVYHEPSA-N |
| XLogP | -1.88 |
| TPSA | 225.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.63 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|