C13H18N4 — CID 146322911
6-methyl-12-propan-2-yl-1,4,7,13-tetrazatricyclo[8.3.0.03,7]trideca-3,5,10,12-tetraene (PubChem CID 146322911) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 6-methyl-12-propan-2-yl-1,4,7,13-tetrazatricyclo[8.3.0.03,7]trideca-3,5,10,12-tetraene.
| Compound Name | 6-methyl-12-propan-2-yl-1,4,7,13-tetrazatricyclo[8.3.0.03,7]trideca-3,5,10,12-tetraene |
|---|---|
| PubChem CID | 146322911 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 6-methyl-12-propan-2-yl-1,4,7,13-tetrazatricyclo[8.3.0.03,7]trideca-3,5,10,12-tetraene |
| SMILES | Cc1cnc2n1CCc1cc(C(C)C)nn1C2 |
| InChI | InChI=1S/C13H18N4/c1-9(2)12-6-11-4-5-16-10(3)7-14-13(16)8-17(11)15-12/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | SPBZINPQRSTEGP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |