C22H42N4O — CID 146322997
9-tert-butyl-7-(2-tert-butyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl)-3-oxa-7,9-diazabicyclo[3.3.1]nonane (PubChem CID 146322997) has the molecular formula C22H42N4O and a molecular weight of 378.61 g/mol. Its IUPAC name is 9-tert-butyl-7-(2-tert-butyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl)-3-oxa-7,9-diazabicyclo[3.3.1]nonane.
| Compound Name | 9-tert-butyl-7-(2-tert-butyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl)-3-oxa-7,9-diazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 146322997 |
| Molecular Formula | C22H42N4O |
| Molecular Weight | 378.61 g/mol |
| Exact Mass | 378.34 |
| IUPAC Name | 9-tert-butyl-7-(2-tert-butyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl)-3-oxa-7,9-diazabicyclo[3.3.1]nonane |
| SMILES | CC(C)(C)N1CCN2CC(N3CC4COCC(C3)N4C(C)(C)C)CCC2C1 |
| InChI | InChI=1S/C22H42N4O/c1-21(2,3)25-10-9-23-11-17(7-8-18(23)14-25)24-12-19-15-27-16-20(13-24)26(19)22(4,5)6/h17-20H,7-16H2,1-6H3 |
| InChIKey | HHNYIMDBMPFNMA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.61 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |