C22H25N4O6PS2 — CID 146323012
2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenoxy]ethyl dihydrogen phosphate (PubChem CID 146323012) has the molecular formula C22H25N4O6PS2 and a molecular weight of 536.57 g/mol. Its IUPAC name is 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenoxy]ethyl dihydrogen phosphate.
| Compound Name | 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenoxy]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 146323012 |
| Molecular Formula | C22H25N4O6PS2 |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.10 |
| IUPAC Name | 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]phenoxy]ethyl dihydrogen phosphate |
| SMILES | CCCCS(=O)c1[nH]c2nc(-c3nccs3)cc(-c3ccc(OCCOP(=O)(O)O)cc3)c2c1N |
| InChI | InChI=1S/C22H25N4O6PS2/c1-2-3-12-35(30)22-19(23)18-16(13-17(25-20(18)26-22)21-24-8-11-34-21)14-4-6-15(7-5-14)31-9-10-32-33(27,28)29/h4-8,11,13H,2-3,9-10,12,23H2,1H3,(H,25,26)(H2,27,28,29) |
| InChIKey | LWYJYABJUSLHGG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 160.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|