C14H17F2N3O3 — CID 146323232
N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-methyl-2-oxopiperidine-4-carboxamide (PubChem CID 146323232) has the molecular formula C14H17F2N3O3 and a molecular weight of 313.30 g/mol. Its IUPAC name is N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-methyl-2-oxopiperidine-4-carboxamide.
| Compound Name | N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-methyl-2-oxopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 146323232 |
| Molecular Formula | C14H17F2N3O3 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-methyl-2-oxopiperidine-4-carboxamide |
| SMILES | CN1CCC(C(=O)Nc2cc(F)c(=O)n(CCF)c2)CC1=O |
| InChI | InChI=1S/C14H17F2N3O3/c1-18-4-2-9(6-12(18)20)13(21)17-10-7-11(16)14(22)19(8-10)5-3-15/h7-9H,2-6H2,1H3,(H,17,21) |
| InChIKey | HDNMNEQOWQCRDY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |