C13H15F2N3O3 — CID 146323234
N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-methyl-5-oxopyrrolidine-2-carboxamide (PubChem CID 146323234) has the molecular formula C13H15F2N3O3 and a molecular weight of 299.28 g/mol. Its IUPAC name is N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-methyl-5-oxopyrrolidine-2-carboxamide.
| Compound Name | N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-methyl-5-oxopyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 146323234 |
| Molecular Formula | C13H15F2N3O3 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]-1-methyl-5-oxopyrrolidine-2-carboxamide |
| SMILES | CN1C(=O)CCC1C(=O)Nc1cc(F)c(=O)n(CCF)c1 |
| InChI | InChI=1S/C13H15F2N3O3/c1-17-10(2-3-11(17)19)12(20)16-8-6-9(15)13(21)18(7-8)5-4-14/h6-7,10H,2-5H2,1H3,(H,16,20) |
| InChIKey | CCRATXAVOOVMKR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |