C13H16ClF2N3O2 — CID 146323247
5-chloro-N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]piperidine-2-carboxamide (PubChem CID 146323247) has the molecular formula C13H16ClF2N3O2 and a molecular weight of 319.74 g/mol. Its IUPAC name is 5-chloro-N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]piperidine-2-carboxamide.
| Compound Name | 5-chloro-N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 146323247 |
| Molecular Formula | C13H16ClF2N3O2 |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 5-chloro-N-[5-fluoro-1-(2-fluoroethyl)-6-oxo-3-pyridinyl]piperidine-2-carboxamide |
| SMILES | O=C(Nc1cc(F)c(=O)n(CCF)c1)C1CCC(Cl)CN1 |
| InChI | InChI=1S/C13H16ClF2N3O2/c14-8-1-2-11(17-6-8)12(20)18-9-5-10(16)13(21)19(7-9)4-3-15/h5,7-8,11,17H,1-4,6H2,(H,18,20) |
| InChIKey | QJXRISPLSZUBRE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|