C36H32N4O4S2 — CID 146323678
6,19-bis(4-oxoheptyl)-7,18-dithia-3,9,16,22-tetrazaoctacyclo[12.12.2.02,9.04,8.011,27.016,23.017,21.024,28]octacosa-1(27),2,4(8),5,11,13,17(21),19,22,24(28),25-undecaene-10,15-dione (PubChem CID 146323678) has the molecular formula C36H32N4O4S2 and a molecular weight of 648.81 g/mol. Its IUPAC name is 6,19-bis(4-oxoheptyl)-7,18-dithia-3,9,16,22-tetrazaoctacyclo[12.12.2.02,9.04,8.011,27.016,23.017,21.024,28]octacosa-1(27),2,4(8),5,11,13,17(21),19,22,24(28),25-undecaene-10,15-dione.
| Compound Name | 6,19-bis(4-oxoheptyl)-7,18-dithia-3,9,16,22-tetrazaoctacyclo[12.12.2.02,9.04,8.011,27.016,23.017,21.024,28]octacosa-1(27),2,4(8),5,11,13,17(21),19,22,24(28),25-undecaene-10,15-dione |
|---|---|
| PubChem CID | 146323678 |
| Molecular Formula | C36H32N4O4S2 |
| Molecular Weight | 648.81 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | 6,19-bis(4-oxoheptyl)-7,18-dithia-3,9,16,22-tetrazaoctacyclo[12.12.2.02,9.04,8.011,27.016,23.017,21.024,28]octacosa-1(27),2,4(8),5,11,13,17(21),19,22,24(28),25-undecaene-10,15-dione |
| SMILES | CCCC(=O)CCCc1cc2nc3c4ccc5c6c(ccc(c(=O)n3c2s1)c46)c(=O)n1c5nc2cc(CCCC(=O)CCC)sc21 |
| InChI | InChI=1S/C36H32N4O4S2/c1-3-7-19(41)9-5-11-21-17-27-35(45-21)39-31(37-27)23-13-14-24-30-26(16-15-25(29(23)30)33(39)43)34(44)40-32(24)38-28-18-22(46-36(28)40)12-6-10-20(42)8-4-2/h13-18H,3-12H2,1-2H3 |
| InChIKey | CUXDYLUYTWTVOO-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 102.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.81 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|