C24H12N4O2S2 — CID 146323741
6,19-dimethyl-7,20-dithia-3,9,16,22-tetrazaoctacyclo[12.12.2.02,9.04,8.011,27.015,22.017,21.024,28]octacosa-1(27),2,4(8),5,11,13,15,17(21),18,24(28),25-undecaene-10,23-dione (PubChem CID 146323741) has the molecular formula C24H12N4O2S2 and a molecular weight of 452.52 g/mol. Its IUPAC name is 6,19-dimethyl-7,20-dithia-3,9,16,22-tetrazaoctacyclo[12.12.2.02,9.04,8.011,27.015,22.017,21.024,28]octacosa-1(27),2,4(8),5,11,13,15,17(21),18,24(28),25-undecaene-10,23-dione.
| Compound Name | 6,19-dimethyl-7,20-dithia-3,9,16,22-tetrazaoctacyclo[12.12.2.02,9.04,8.011,27.015,22.017,21.024,28]octacosa-1(27),2,4(8),5,11,13,15,17(21),18,24(28),25-undecaene-10,23-dione |
|---|---|
| PubChem CID | 146323741 |
| Molecular Formula | C24H12N4O2S2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.04 |
| IUPAC Name | 6,19-dimethyl-7,20-dithia-3,9,16,22-tetrazaoctacyclo[12.12.2.02,9.04,8.011,27.015,22.017,21.024,28]octacosa-1(27),2,4(8),5,11,13,15,17(21),18,24(28),25-undecaene-10,23-dione |
| SMILES | Cc1cc2nc3c4ccc5c(=O)n6c(nc7cc(C)sc76)c6ccc(c(=O)n3c2s1)c4c56 |
| InChI | InChI=1S/C24H12N4O2S2/c1-9-7-15-23(31-9)27-19(25-15)11-3-6-14-18-12(4-5-13(17(11)18)21(27)29)20-26-16-8-10(2)32-24(16)28(20)22(14)30/h3-8H,1-2H3 |
| InChIKey | RKBNBMWLFOIEHR-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 68.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|