About (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite
(2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite (PubChem CID 146323888) has the molecular formula C7H5ClFN3OS
and a molecular weight of 233.66 g/mol. Its IUPAC name is (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite.
Molecular Properties
| Compound Name | (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite |
| PubChem CID | 146323888 |
| Molecular Formula | C7H5ClFN3OS |
| Molecular Weight | 233.66 g/mol |
| Exact Mass | 232.98 |
| IUPAC Name | (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite |
| SMILES | Cc1cn(SF)c2nc(Cl)[nH]c(=O)c12 |
| InChI | InChI=1S/C7H5ClFN3OS/c1-3-2-12(14-9)5-4(3)6(13)11-7(8)10-5/h2H,1H3,(H,10,11,13) |
| InChIKey | WOQNVHRTLMCWLZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.66 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite?
The IUPAC name of (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite (CID 146323888) is (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite.
What is the SMILES notation for (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite?
The canonical SMILES for (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite is Cc1cn(SF)c2nc(Cl)[nH]c(=O)c12.
What is the InChIKey of (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite?
The InChIKey is WOQNVHRTLMCWLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClFN3OS/c1-3-2-12(14-9)5-4(3)6(13)11-7(8)10-5/h2H,1H3,(H,10,11,13).
What are the key properties of (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite?
(2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite has a molecular weight of 233.66 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-5-methyl-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-7-yl) thiohypofluorite is sourced from PubChem (CID 146323888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).