C18H17N5O2 — CID 146324027
4-(morpholin-4-ylmethyl)-2,8,15,16-tetrazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),3,5,7,9,11,13(17)-heptaen-14-one (PubChem CID 146324027) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 4-(morpholin-4-ylmethyl)-2,8,15,16-tetrazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),3,5,7,9,11,13(17)-heptaen-14-one.
| Compound Name | 4-(morpholin-4-ylmethyl)-2,8,15,16-tetrazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),3,5,7,9,11,13(17)-heptaen-14-one |
|---|---|
| PubChem CID | 146324027 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 4-(morpholin-4-ylmethyl)-2,8,15,16-tetrazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),3,5,7,9,11,13(17)-heptaen-14-one |
| SMILES | O=c1[nH]nc2c3c(cccc13)N=C1C=CC(CN3CCOCC3)=CN12 |
| InChI | InChI=1S/C18H17N5O2/c24-18-13-2-1-3-14-16(13)17(20-21-18)23-11-12(4-5-15(23)19-14)10-22-6-8-25-9-7-22/h1-5,11H,6-10H2,(H,21,24) |
| InChIKey | VAOWBFCSSSUJKK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 73.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |