C30H32FN3O2 — CID 146325881
6-[(2E)-4-[(2-fluoro-4-methyl-3-prop-1-en-2-ylphenyl)methyl-methylcarbamoyl]-2-methylpenta-2,4-dienyl]-3-methylquinoline-8-carboxamide (PubChem CID 146325881) has the molecular formula C30H32FN3O2 and a molecular weight of 485.60 g/mol. Its IUPAC name is 6-[(2E)-4-[(2-fluoro-4-methyl-3-prop-1-en-2-ylphenyl)methyl-methylcarbamoyl]-2-methylpenta-2,4-dienyl]-3-methylquinoline-8-carboxamide.
| Compound Name | 6-[(2E)-4-[(2-fluoro-4-methyl-3-prop-1-en-2-ylphenyl)methyl-methylcarbamoyl]-2-methylpenta-2,4-dienyl]-3-methylquinoline-8-carboxamide |
|---|---|
| PubChem CID | 146325881 |
| Molecular Formula | C30H32FN3O2 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | 6-[(2E)-4-[(2-fluoro-4-methyl-3-prop-1-en-2-ylphenyl)methyl-methylcarbamoyl]-2-methylpenta-2,4-dienyl]-3-methylquinoline-8-carboxamide |
| SMILES | C=C(/C=C(\C)Cc1cc(C(N)=O)c2ncc(C)cc2c1)C(=O)N(C)Cc1ccc(C)c(C(=C)C)c1F |
| InChI | InChI=1S/C30H32FN3O2/c1-17(2)26-20(5)8-9-23(27(26)31)16-34(7)30(36)21(6)10-18(3)11-22-13-24-12-19(4)15-33-28(24)25(14-22)29(32)35/h8-10,12-15H,1,6,11,16H2,2-5,7H3,(H2,32,35)/b18-10+ |
| InChIKey | XIABRUDDMIRZCD-VCHYOVAHSA-N |
| XLogP | 5.83 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|