About 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine
1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine (PubChem CID 146325910) has the molecular formula C6H11FN2
and a molecular weight of 130.17 g/mol. Its IUPAC name is 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine.
Molecular Properties
| Compound Name | 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine |
| PubChem CID | 146325910 |
| Molecular Formula | C6H11FN2 |
| Molecular Weight | 130.17 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine |
| SMILES | C=C(F)/C=C(\C)NNC |
| InChI | InChI=1S/C6H11FN2/c1-5(7)4-6(2)9-8-3/h4,8-9H,1H2,2-3H3/b6-4+ |
| InChIKey | XHPYUPGMHLHIAN-GQCTYLIASA-N |
| XLogP | 1.10 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.17 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine?
The IUPAC name of 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine (CID 146325910) is 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine.
What is the SMILES notation for 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine?
The canonical SMILES for 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine is C=C(F)/C=C(\C)NNC.
What is the InChIKey of 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine?
The InChIKey is XHPYUPGMHLHIAN-GQCTYLIASA-N. The full InChI is InChI=1S/C6H11FN2/c1-5(7)4-6(2)9-8-3/h4,8-9H,1H2,2-3H3/b6-4+.
What are the key properties of 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine?
1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine has a molecular weight of 130.17 g/mol, XLogP of 1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2E)-4-fluoropenta-2,4-dien-2-yl]-2-methylhydrazine is sourced from PubChem (CID 146325910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).