C18H22F2N2O6S — CID 146326202
(2,4-difluorophenyl)-[2-[(2,3,4,5,7-pentahydroxy-6-methylheptyl)amino]-1,3-thiazol-5-yl]methanone (PubChem CID 146326202) has the molecular formula C18H22F2N2O6S and a molecular weight of 432.45 g/mol. Its IUPAC name is (2,4-difluorophenyl)-[2-[(2,3,4,5,7-pentahydroxy-6-methylheptyl)amino]-1,3-thiazol-5-yl]methanone.
| Compound Name | (2,4-difluorophenyl)-[2-[(2,3,4,5,7-pentahydroxy-6-methylheptyl)amino]-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 146326202 |
| Molecular Formula | C18H22F2N2O6S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (2,4-difluorophenyl)-[2-[(2,3,4,5,7-pentahydroxy-6-methylheptyl)amino]-1,3-thiazol-5-yl]methanone |
| SMILES | CC(CO)C(O)C(O)C(O)C(O)CNc1ncc(C(=O)c2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C18H22F2N2O6S/c1-8(7-23)14(25)17(28)16(27)12(24)5-21-18-22-6-13(29-18)15(26)10-3-2-9(19)4-11(10)20/h2-4,6,8,12,14,16-17,23-25,27-28H,5,7H2,1H3,(H,21,22) |
| InChIKey | ZDLMOSMBTFNBAB-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |