C12H15N3O3 — CID 146326230
6-hydroxy-1-propyl-3,5-bis(prop-2-ynyl)-1,3,5-triazinane-2,4-dione (PubChem CID 146326230) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 6-hydroxy-1-propyl-3,5-bis(prop-2-ynyl)-1,3,5-triazinane-2,4-dione.
| Compound Name | 6-hydroxy-1-propyl-3,5-bis(prop-2-ynyl)-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 146326230 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 6-hydroxy-1-propyl-3,5-bis(prop-2-ynyl)-1,3,5-triazinane-2,4-dione |
| SMILES | C#CCN1C(=O)N(CC#C)C(O)N(CCC)C1=O |
| InChI | InChI=1S/C12H15N3O3/c1-4-7-13-10(16)14(8-5-2)12(18)15(9-6-3)11(13)17/h1-2,11,17H,6-9H2,3H3 |
| InChIKey | HHUFOXJUMSFAIU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|