C12H19N3O3 — CID 146326246
6-hydroxy-1,5-dipropyl-3-prop-2-ynyl-1,3,5-triazinane-2,4-dione (PubChem CID 146326246) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 6-hydroxy-1,5-dipropyl-3-prop-2-ynyl-1,3,5-triazinane-2,4-dione.
| Compound Name | 6-hydroxy-1,5-dipropyl-3-prop-2-ynyl-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 146326246 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 6-hydroxy-1,5-dipropyl-3-prop-2-ynyl-1,3,5-triazinane-2,4-dione |
| SMILES | C#CCN1C(=O)N(CCC)C(O)N(CCC)C1=O |
| InChI | InChI=1S/C12H19N3O3/c1-4-7-13-10(16)14(8-5-2)12(18)15(9-6-3)11(13)17/h1,12,18H,5-9H2,2-3H3 |
| InChIKey | ORCBJMHYVYSPDD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|